CAS 21814-48-2 is the registry number for 1-chloro-7-methoxy-4-nitro-9,10-dihydroacridin-9-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-chloro-7-methoxy-4-nitro-10H-acridin-9-one (CAS 21814-48-2) is a chemical compound with the molecular formula C14H9ClN2O4 and a molecular weight of 304.68 g/mol. IUPAC name: 1-chloro-7-methoxy-4-nitro-10H-acridin-9-one. InChIKey: WUQQKUISNKRKFK-UHFFFAOYSA-N.
| Molecular formula | C14H9ClN2O4 |
|---|---|
| Molecular weight | 304.68 g/mol |
| IUPAC name | 1-chloro-7-methoxy-4-nitro-10H-acridin-9-one |
| InChIKey | WUQQKUISNKRKFK-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)NC3=C(C=CC(=C3C2=O)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)