CAS 25356-27-8 is the registry number for 1,5-Diamino-2-chloro-4,8-dihydroxy-9,10-anthracenedione. Offered by: TRC. Available pack sizes: 100mg.
1,5-diamino-2-chloro-4,8-dihydroxyanthracene-9,10-dione (CAS 25356-27-8) is a chemical compound with the molecular formula C14H9ClN2O4 and a molecular weight of 304.68 g/mol. IUPAC name: 1,5-diamino-2-chloro-4,8-dihydroxyanthracene-9,10-dione. InChIKey: SIRMWLMEYFPGAD-UHFFFAOYSA-N.
| Molecular formula | C14H9ClN2O4 |
|---|---|
| Molecular weight | 304.68 g/mol |
| IUPAC name | 1,5-diamino-2-chloro-4,8-dihydroxyanthracene-9,10-dione |
| InChIKey | SIRMWLMEYFPGAD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1N)C(=O)C3=C(C2=O)C(=C(C=C3O)Cl)N)O |
Computed by PubChem (NCBI)