Products 1221723-01-8
CAS 1221723-01-8 is the registry number for 2-(1H-Pyrazol-4-yl)-2-azaspiro(4.4)nonane-1,3-dione hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-(1H-pyrazol-4-yl)-2-azaspiro[4.4]nonane-1,3-dione;hydrochloride (CAS 1221723-01-8) is a chemical compound with the molecular formula C11H14ClN3O2 and a molecular weight of 255.70 g/mol. IUPAC name: 2-(1H-pyrazol-4-yl)-2-azaspiro[4.4]nonane-1,3-dione;hydrochloride. InChIKey: DJIVBBMMCFSYCL-UHFFFAOYSA-N.
| Molecular formula | C11H14ClN3O2 |
|---|---|
| Molecular weight | 255.70 g/mol |
| IUPAC name | 2-(1H-pyrazol-4-yl)-2-azaspiro[4.4]nonane-1,3-dione;hydrochloride |
| InChIKey | DJIVBBMMCFSYCL-UHFFFAOYSA-N |
| SMILES | C1CCC2(C1)CC(=O)N(C2=O)C3=CNN=C3.Cl |
Computed by PubChem (NCBI)