CAS 1221724-85-1 appears in our catalog under these names: 5-(2-Bromo-5-methoxyphenyl)-1h-1,2,3,4-tetrazole, 95%, 5-(2-Bromo-5-methoxyphenyl)-1H-1,2,3,4-tetrazole. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
5-(2-bromo-5-methoxyphenyl)-2H-tetrazole (CAS 1221724-85-1) is a chemical compound with the molecular formula C8H7BrN4O and a molecular weight of 255.07 g/mol. IUPAC name: 5-(2-bromo-5-methoxyphenyl)-2H-tetrazole. InChIKey: FXHANGPBTIMOLF-UHFFFAOYSA-N.
| Molecular formula | C8H7BrN4O |
|---|---|
| Molecular weight | 255.07 g/mol |
| IUPAC name | 5-(2-bromo-5-methoxyphenyl)-2H-tetrazole |
| InChIKey | FXHANGPBTIMOLF-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)Br)C2=NNN=N2 |
Computed by PubChem (NCBI)