Products 915190-04-4
CAS 915190-04-4 is the registry number for 7-Amino-5-bromo-2-methylpyrido[4,3-d]pyrimidin-4(3H)-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
7-amino-5-bromo-2-methyl-3H-pyrido[4,3-d]pyrimidin-4-one (CAS 915190-04-4) is a chemical compound with the molecular formula C8H7BrN4O and a molecular weight of 255.07 g/mol. IUPAC name: 7-amino-5-bromo-2-methyl-3H-pyrido[4,3-d]pyrimidin-4-one. InChIKey: LPCQVRJRGRBDRL-UHFFFAOYSA-N.
| Molecular formula | C8H7BrN4O |
|---|---|
| Molecular weight | 255.07 g/mol |
| IUPAC name | 7-amino-5-bromo-2-methyl-3H-pyrido[4,3-d]pyrimidin-4-one |
| InChIKey | LPCQVRJRGRBDRL-UHFFFAOYSA-N |
| SMILES | CC1=NC2=CC(=NC(=C2C(=O)N1)Br)N |
Computed by PubChem (NCBI)