CAS 1427460-82-9 is the registry number for 3-Bromoimidazo[1,2-a]pyridine-7-carbohydrazide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
3-bromoimidazo[1,2-a]pyridine-7-carbohydrazide (CAS 1427460-82-9) is a chemical compound with the molecular formula C8H7BrN4O and a molecular weight of 255.07 g/mol. IUPAC name: 3-bromoimidazo[1,2-a]pyridine-7-carbohydrazide. InChIKey: RDDPPYAFZKDHNQ-UHFFFAOYSA-N.
| Molecular formula | C8H7BrN4O |
|---|---|
| Molecular weight | 255.07 g/mol |
| IUPAC name | 3-bromoimidazo[1,2-a]pyridine-7-carbohydrazide |
| InChIKey | RDDPPYAFZKDHNQ-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=NC=C2Br)C=C1C(=O)NN |
Computed by PubChem (NCBI)