CAS 474956-06-4 is the registry number for 6-Bromo-imidazo[1,2-a]pyridine-2-carbohydrazide, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
6-bromoimidazo[1,2-a]pyridine-2-carbohydrazide (CAS 474956-06-4) is a chemical compound with the molecular formula C8H7BrN4O and a molecular weight of 255.07 g/mol. IUPAC name: 6-bromoimidazo[1,2-a]pyridine-2-carbohydrazide. InChIKey: GTCANPWWELAJSG-UHFFFAOYSA-N.
| Molecular formula | C8H7BrN4O |
|---|---|
| Molecular weight | 255.07 g/mol |
| IUPAC name | 6-bromoimidazo[1,2-a]pyridine-2-carbohydrazide |
| InChIKey | GTCANPWWELAJSG-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC(=CN2C=C1Br)C(=O)NN |
Computed by PubChem (NCBI)