Products 1221725-53-6
CAS 1221725-53-6 is the registry number for 1-Methyl-5-((1-methyl-6-oxo-1,6-dihydropyridin-3-yl)amino)-1,2-dihydropyridin-2-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-methyl-5-[(1-methyl-6-oxo-3-pyridinyl)amino]pyridin-2-one (CAS 1221725-53-6) is a chemical compound with the molecular formula C12H13N3O2 and a molecular weight of 231.25 g/mol. IUPAC name: 1-methyl-5-[(1-methyl-6-oxo-3-pyridinyl)amino]pyridin-2-one. InChIKey: WIBNMZXDRICYLF-UHFFFAOYSA-N.
| Molecular formula | C12H13N3O2 |
|---|---|
| Molecular weight | 231.25 g/mol |
| IUPAC name | 1-methyl-5-[(1-methyl-6-oxo-3-pyridinyl)amino]pyridin-2-one |
| InChIKey | WIBNMZXDRICYLF-UHFFFAOYSA-N |
| SMILES | CN1C=C(C=CC1=O)NC2=CN(C(=O)C=C2)C |
Computed by PubChem (NCBI)