Products 1221792-65-9
CAS 1221792-65-9 is the registry number for Methyl 5-bromo-2-methyl-1,3-benzoxazole-7-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Methyl 5-bromo-2-methyl-1,3-benzoxazole-7-carboxylate (CAS 1221792-65-9) is a chemical compound with the molecular formula C10H8BrNO3 and a molecular weight of 270.08 g/mol. IUPAC name: methyl 5-bromo-2-methyl-1,3-benzoxazole-7-carboxylate. InChIKey: MVPHFLJLVCCXGG-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO3 |
|---|---|
| Molecular weight | 270.08 g/mol |
| IUPAC name | methyl 5-bromo-2-methyl-1,3-benzoxazole-7-carboxylate |
| InChIKey | MVPHFLJLVCCXGG-UHFFFAOYSA-N |
| SMILES | CC1=NC2=CC(=CC(=C2O1)C(=O)OC)Br |
Computed by PubChem (NCBI)