CAS 81224-15-9 is the registry number for 7-Bromo-4-methoxy-1h-indole-2-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g, 100mg, 10g.
7-bromo-4-methoxy-1H-indole-2-carboxylic acid (CAS 81224-15-9) is a chemical compound with the molecular formula C10H8BrNO3 and a molecular weight of 270.08 g/mol. IUPAC name: 7-bromo-4-methoxy-1H-indole-2-carboxylic acid. InChIKey: LTXFQVZKWCXSFQ-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO3 |
|---|---|
| Molecular weight | 270.08 g/mol |
| IUPAC name | 7-bromo-4-methoxy-1H-indole-2-carboxylic acid |
| InChIKey | LTXFQVZKWCXSFQ-UHFFFAOYSA-N |
| SMILES | COC1=C2C=C(NC2=C(C=C1)Br)C(=O)O |
Computed by PubChem (NCBI)