Products 36847-85-5
CAS 36847-85-5 appears in our catalog under these names: 3-[(2-Bromophenyl)carbamoyl]prop-2-enoic acid, 95%, 4-((2-Bromophenyl)amino)-4-oxobut-2-enoic acid, 95+%, 3-((2-Bromophenyl)carbamoyl)prop-2-enoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g, 0,5g.
(E)-4-(2-bromoanilino)-4-oxobut-2-enoic acid (CAS 36847-85-5) is a chemical compound with the molecular formula C10H8BrNO3 and a molecular weight of 270.08 g/mol. IUPAC name: (E)-4-(2-bromoanilino)-4-oxobut-2-enoic acid. InChIKey: CJHBOIXAXNGQNF-AATRIKPKSA-N.
| Molecular formula | C10H8BrNO3 |
|---|---|
| Molecular weight | 270.08 g/mol |
| IUPAC name | (E)-4-(2-bromoanilino)-4-oxobut-2-enoic acid |
| InChIKey | CJHBOIXAXNGQNF-AATRIKPKSA-N |
| SMILES | C1=CC=C(C(=C1)NC(=O)/C=C/C(=O)O)Br |
Computed by PubChem (NCBI)