CAS 124522-09-4 appears in our catalog under these names: 3-Bromomethyl-7-methoxy-1,4-benzoxazin-2-one, 95%, 3-(Bromomethyl)-7-methoxy-2H-benzo(b)(1,4)oxazin-2-one, 98%, 3-Bromomethyl-7-methoxy-1,4-benzoxazin-2-one [for HPLC Labeling], >98.0%(T), 3-(Bromomethyl)-7-methoxy-2H-benzo[b][1,4]oxazin-2-one, 98.0%, 98.0%, 2H-1,4-Benzoxazin-2-one, 3-(bromomethyl)-7-methoxy-, ≥98%(T). Offered by: Combi-blocks, AmBeed, TCI, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 5g, 250mg.
3-(bromomethyl)-7-methoxy-1,4-benzoxazin-2-one (CAS 124522-09-4) is a chemical compound with the molecular formula C10H8BrNO3 and a molecular weight of 270.08 g/mol. IUPAC name: 3-(bromomethyl)-7-methoxy-1,4-benzoxazin-2-one. InChIKey: XFCZURAACWKKIH-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO3 |
|---|---|
| Molecular weight | 270.08 g/mol |
| IUPAC name | 3-(bromomethyl)-7-methoxy-1,4-benzoxazin-2-one |
| InChIKey | XFCZURAACWKKIH-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)N=C(C(=O)O2)CBr |
Computed by PubChem (NCBI)