CAS 122225-33-6 appears in our catalog under these names: (R)–2–Benzyl–4–(tert–butoxy)–4–oxobutanoic acid, (R)-2-Benzyl-4-(tert-butoxy)-4-oxobutanoic acid 97%, (R)-2-Benzyl-4-(tert-butoxy)-4-oxobutanoic acid, 97%, 97%, (R)-2-Benzyl-4-(tert-butoxy)-4-oxobutanoic acid, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 25mg, 5g.
(2R)-2-benzyl-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid (CAS 122225-33-6) is a chemical compound with the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. IUPAC name: (2R)-2-benzyl-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid. InChIKey: TWMRLCPQQCHIBH-GFCCVEGCSA-N.
| Molecular formula | C15H20O4 |
|---|---|
| Molecular weight | 264.32 g/mol |
| IUPAC name | (2R)-2-benzyl-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid |
| InChIKey | TWMRLCPQQCHIBH-GFCCVEGCSA-N |
| SMILES | CC(C)(C)OC(=O)C[C@@H](CC1=CC=CC=C1)C(=O)O |
Computed by PubChem (NCBI)