Products 1222976-14-8
CAS 1222976-14-8 is the registry number for 3,5-Dimethyl-1-(3-methylfuran-2-carbonyl)piperidine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(3,5-dimethylpiperidin-1-yl)-(3-methylfuran-2-yl)methanone (CAS 1222976-14-8) is a chemical compound with the molecular formula C13H19NO2 and a molecular weight of 221.29 g/mol. IUPAC name: (3,5-dimethylpiperidin-1-yl)-(3-methylfuran-2-yl)methanone. InChIKey: DEFAOUGAKFMTBM-UHFFFAOYSA-N.
| Molecular formula | C13H19NO2 |
|---|---|
| Molecular weight | 221.29 g/mol |
| IUPAC name | (3,5-dimethylpiperidin-1-yl)-(3-methylfuran-2-yl)methanone |
| InChIKey | DEFAOUGAKFMTBM-UHFFFAOYSA-N |
| SMILES | CC1CC(CN(C1)C(=O)C2=C(C=CO2)C)C |
Computed by PubChem (NCBI)