Products 1223015-79-9
CAS 1223015-79-9 is the registry number for Methyl 1,3,7-trimethyl-2,4-dioxo-1H,2H,3H,4H,7H-pyrrolo(2,3-d)pyrimidine-6-carboxylate. Offered by: Biosynth. Available pack sizes: 250mg.
Methyl 1,3,7-trimethyl-2,4-dioxopyrrolo[2,3-d]pyrimidine-6-carboxylate (CAS 1223015-79-9) is a chemical compound with the molecular formula C11H13N3O4 and a molecular weight of 251.24 g/mol. IUPAC name: methyl 1,3,7-trimethyl-2,4-dioxopyrrolo[2,3-d]pyrimidine-6-carboxylate. InChIKey: ZAXFQYBFPZWZJH-UHFFFAOYSA-N.
| Molecular formula | C11H13N3O4 |
|---|---|
| Molecular weight | 251.24 g/mol |
| IUPAC name | methyl 1,3,7-trimethyl-2,4-dioxopyrrolo[2,3-d]pyrimidine-6-carboxylate |
| InChIKey | ZAXFQYBFPZWZJH-UHFFFAOYSA-N |
| SMILES | CN1C(=CC2=C1N(C(=O)N(C2=O)C)C)C(=O)OC |
Computed by PubChem (NCBI)