Products 1223237-60-2
CAS 1223237-60-2 is the registry number for 5-Bromo-N-((2-methylthiazol-4-yl)methyl)nicotinamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-N-[(2-methyl-1,3-thiazol-4-yl)methyl]pyridine-3-carboxamide (CAS 1223237-60-2) is a chemical compound with the molecular formula C11H10BrN3OS and a molecular weight of 312.19 g/mol. IUPAC name: 5-bromo-N-[(2-methyl-1,3-thiazol-4-yl)methyl]pyridine-3-carboxamide. InChIKey: NBPZGAWPWQRXHB-UHFFFAOYSA-N.
| Molecular formula | C11H10BrN3OS |
|---|---|
| Molecular weight | 312.19 g/mol |
| IUPAC name | 5-bromo-N-[(2-methyl-1,3-thiazol-4-yl)methyl]pyridine-3-carboxamide |
| InChIKey | NBPZGAWPWQRXHB-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CS1)CNC(=O)C2=CC(=CN=C2)Br |
Computed by PubChem (NCBI)