Products 497060-01-2
CAS 497060-01-2 is the registry number for N-(5-bromo-4,6-dimethylpyrimidin-2-yl)-2-thienylformamide. Offered by: Biosynth. Available pack sizes: 250mg.
N-(5-bromo-4,6-dimethylpyrimidin-2-yl)thiophene-2-carboxamide (CAS 497060-01-2) is a chemical compound with the molecular formula C11H10BrN3OS and a molecular weight of 312.19 g/mol. IUPAC name: N-(5-bromo-4,6-dimethylpyrimidin-2-yl)thiophene-2-carboxamide. InChIKey: IERYGESLBYDWGK-UHFFFAOYSA-N.
| Molecular formula | C11H10BrN3OS |
|---|---|
| Molecular weight | 312.19 g/mol |
| IUPAC name | N-(5-bromo-4,6-dimethylpyrimidin-2-yl)thiophene-2-carboxamide |
| InChIKey | IERYGESLBYDWGK-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NC(=N1)NC(=O)C2=CC=CS2)C)Br |
Computed by PubChem (NCBI)