Products 166751-41-3
CAS 166751-41-3 is the registry number for 6-Amino-2-{[(3-bromophenyl)methyl]sulfanyl}-3,4-dihydropyrimidin-4-one, 96%, 96%. Offered by: Chemat. Available pack sizes: 1g, 5g.
4-amino-2-[(3-bromophenyl)methylsulfanyl]-1H-pyrimidin-6-one (CAS 166751-41-3) is a chemical compound with the molecular formula C11H10BrN3OS and a molecular weight of 312.19 g/mol. IUPAC name: 4-amino-2-[(3-bromophenyl)methylsulfanyl]-1H-pyrimidin-6-one. InChIKey: GJPRMOUJVPHXDS-UHFFFAOYSA-N.
| Molecular formula | C11H10BrN3OS |
|---|---|
| Molecular weight | 312.19 g/mol |
| IUPAC name | 4-amino-2-[(3-bromophenyl)methylsulfanyl]-1H-pyrimidin-6-one |
| InChIKey | GJPRMOUJVPHXDS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)CSC2=NC(=CC(=O)N2)N |
Computed by PubChem (NCBI)