CAS 37664-35-0 is the registry number for 1-(4-Bromophenyl)-2-[(5-methyl-4h-1,2,4-triazol-3-yl)thio]ethanone, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
1-(4-bromophenyl)-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethanone (CAS 37664-35-0) is a chemical compound with the molecular formula C11H10BrN3OS and a molecular weight of 312.19 g/mol. IUPAC name: 1-(4-bromophenyl)-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethanone. InChIKey: UDDXBSNUZDFMOF-UHFFFAOYSA-N.
| Molecular formula | C11H10BrN3OS |
|---|---|
| Molecular weight | 312.19 g/mol |
| IUPAC name | 1-(4-bromophenyl)-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethanone |
| InChIKey | UDDXBSNUZDFMOF-UHFFFAOYSA-N |
| SMILES | CC1=NC(=NN1)SCC(=O)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)