CAS 122334-36-5 appears in our catalog under these names: 4,N-Dimethyl-n-methoxybenzamide, 95%, N-Methoxy-N,4-dimethylbenzamide, 95%, N–Methoxy–N,4–dimethylbenzamide, N-Methoxy-N,4-dimethylbenzamide, >95.0%(GC), N-Methoxy-N,4-dimethylbenzamide, 98%, 98%. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 5g, 1g, 250mg, 25g.
N-methoxy-N,4-dimethylbenzamide (CAS 122334-36-5) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: N-methoxy-N,4-dimethylbenzamide. InChIKey: JFLVXYRFUSRSCR-UHFFFAOYSA-N.
| Molecular formula | C10H13NO2 |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | N-methoxy-N,4-dimethylbenzamide |
| InChIKey | JFLVXYRFUSRSCR-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)N(C)OC |
Computed by PubChem (NCBI)