CAS 1223354-08-2 appears in our catalog under these names: 3-(5-Amino-1,3,4-oxadiazol-2-yl)benzene-1-carbothioamide, 95%, 3-(5-Amino-1,3,4-oxadiazol-2-yl)benzene-1-carbothioamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
3-(5-amino-1,3,4-oxadiazol-2-yl)benzenecarbothioamide (CAS 1223354-08-2) is a chemical compound with the molecular formula C9H8N4OS and a molecular weight of 220.25 g/mol. IUPAC name: 3-(5-amino-1,3,4-oxadiazol-2-yl)benzenecarbothioamide. InChIKey: QHMNKYTYUZYLLA-UHFFFAOYSA-N.
| Molecular formula | C9H8N4OS |
|---|---|
| Molecular weight | 220.25 g/mol |
| IUPAC name | 3-(5-amino-1,3,4-oxadiazol-2-yl)benzenecarbothioamide |
| InChIKey | QHMNKYTYUZYLLA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=S)N)C2=NN=C(O2)N |
Computed by PubChem (NCBI)