CAS 27830-79-1 appears in our catalog under these names: Isatin-β-thiosemicarbazone/ 98.23% (existing batch purity), Isatin–β–thiosemicarbazone, (Z)-2-(2-Oxoindolin-3-ylidene)hydrazine-1-carbothioamide, 98%, 98%, Isatin-β-thiosemicarbazone, 99.58%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 250mg.
(2-hydroxy-1H-indol-3-yl)iminothiourea (CAS 27830-79-1) is a chemical compound with the molecular formula C9H8N4OS and a molecular weight of 220.25 g/mol. IUPAC name: (2-hydroxy-1H-indol-3-yl)iminothiourea. InChIKey: PEYNLAQGUNUQLY-UHFFFAOYSA-N.
| Molecular formula | C9H8N4OS |
|---|---|
| Molecular weight | 220.25 g/mol |
| IUPAC name | (2-hydroxy-1H-indol-3-yl)iminothiourea |
| InChIKey | PEYNLAQGUNUQLY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(N2)O)N=NC(=S)N |
Computed by PubChem (NCBI)