CAS 92432-91-2 appears in our catalog under these names: N-(4-Oxo-4h-1,3-benzothiazin-2-yl)guanidine, 95%, 1-(4-Oxo-4H-benzo(e)(1,3)thiazin-2-yl)guanidine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
2-(4-oxo-1,3-benzothiazin-2-yl)guanidine (CAS 92432-91-2) is a chemical compound with the molecular formula C9H8N4OS and a molecular weight of 220.25 g/mol. IUPAC name: 2-(4-oxo-1,3-benzothiazin-2-yl)guanidine. InChIKey: YXHIFFNKAYEVEC-UHFFFAOYSA-N.
| Molecular formula | C9H8N4OS |
|---|---|
| Molecular weight | 220.25 g/mol |
| IUPAC name | 2-(4-oxo-1,3-benzothiazin-2-yl)guanidine |
| InChIKey | YXHIFFNKAYEVEC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N=C(S2)N=C(N)N |
Computed by PubChem (NCBI)