CAS 27161-64-4 is the registry number for 6-(2-Aminophenyl)-3-mercapto-1,2,4-triazin-5(4h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
6-(2-aminophenyl)-3-sulfanylidene-2H-1,2,4-triazin-5-one (CAS 27161-64-4) is a chemical compound with the molecular formula C9H8N4OS and a molecular weight of 220.25 g/mol. IUPAC name: 6-(2-aminophenyl)-3-sulfanylidene-2H-1,2,4-triazin-5-one. InChIKey: TZQIBJNEKJDVAM-UHFFFAOYSA-N.
| Molecular formula | C9H8N4OS |
|---|---|
| Molecular weight | 220.25 g/mol |
| IUPAC name | 6-(2-aminophenyl)-3-sulfanylidene-2H-1,2,4-triazin-5-one |
| InChIKey | TZQIBJNEKJDVAM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NNC(=S)NC2=O)N |
Computed by PubChem (NCBI)