CAS 122350-52-1 appears in our catalog under these names: (S)–4–((((9H–Fluoren–9–yl)methoxy)carbonyl)amino)–5–(benzyloxy)–5–oxopentanoic acid, N-Fmoc-L-glutamic acid 1-benzyl ester, 95% , Fmoc-Glu-OBzl 97%, N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-glutamic acid 1-(phenylmethyl) ester, 96%, 96%, (S)-4-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-5-(benzyloxy)-5-oxopentanoic acid, 96%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 10g, 25g, 5g, 1g, 1kg, 500g.
(4S)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxo-5-phenylmethoxypentanoic acid (CAS 122350-52-1) is a chemical compound with the molecular formula C27H25NO6 and a molecular weight of 459.5 g/mol. IUPAC name: (4S)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxo-5-phenylmethoxypentanoic acid. InChIKey: FMWLYDDRYGOYMY-DEOSSOPVSA-N.
| Molecular formula | C27H25NO6 |
|---|---|
| Molecular weight | 459.5 g/mol |
| IUPAC name | (4S)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxo-5-phenylmethoxypentanoic acid |
| InChIKey | FMWLYDDRYGOYMY-DEOSSOPVSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)[C@H](CCC(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)