CAS 123639-61-2 appears in our catalog under these names: Fmoc–Glu(OBzl)–OH, Fmoc-L-Glu(OBzl)-OH, Fmoc-Glu(OBzl)-OH 97%, Fmoc-Glu(OBzl)-OH, 98%, 98%, Fmoc-Glu(OBzl)-OH, 99.84%. Offered by: GLPBio, Iris Biotech, Ambeed, Chemat, MedChemExpress. Available pack sizes: 100g, 5g, 25g, 1g, 10g, 500g, 100 g, 25 g.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxo-5-phenylmethoxypentanoic acid (CAS 123639-61-2) is a chemical compound with the molecular formula C27H25NO6 and a molecular weight of 459.5 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxo-5-phenylmethoxypentanoic acid. InChIKey: HJJURMMMGPQIQP-DEOSSOPVSA-N.
| Molecular formula | C27H25NO6 |
|---|---|
| Molecular weight | 459.5 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxo-5-phenylmethoxypentanoic acid |
| InChIKey | HJJURMMMGPQIQP-DEOSSOPVSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)CC[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)