Products 125760-27-2
CAS 125760-27-2 appears in our catalog under these names: N-(9-Fluorenylmethoxycarbonyl)threonine Phenacyl Ester, Fmoc–Thr–OPAC, Fmoc-Thr-OPAC. Offered by: TRC, GLPBio, Biosynth. Available pack sizes: 100mg, 100g, 25g, 2g, 5g.
Phenacyl (2S,3R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxybutanoate (CAS 125760-27-2) is a chemical compound with the molecular formula C27H25NO6 and a molecular weight of 459.5 g/mol. IUPAC name: phenacyl (2S,3R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxybutanoate. InChIKey: FLSCFYIUFWADFU-NSYGIPOTSA-N.
| Molecular formula | C27H25NO6 |
|---|---|
| Molecular weight | 459.5 g/mol |
| IUPAC name | phenacyl (2S,3R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxybutanoate |
| InChIKey | FLSCFYIUFWADFU-NSYGIPOTSA-N |
| SMILES | C[C@H]([C@@H](C(=O)OCC(=O)C1=CC=CC=C1)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)O |
Computed by PubChem (NCBI)