Products 131451-30-4
CAS 131451-30-4 appears in our catalog under these names: Fmoc-N-Me-Asp(OBzl)-OH, FMOC-N-ME-ASP(OBZL)-OH, 98%, 98%, N-Fmoc-N-Me-Asp(OBn)-OH, 98%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 1000mg, 2000mg, 5000mg, 10000mg, 100mg, 250mg, 1g, 5g.
(2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-4-oxo-4-phenylmethoxybutanoic acid (CAS 131451-30-4) is a chemical compound with the molecular formula C27H25NO6 and a molecular weight of 459.5 g/mol. IUPAC name: (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-4-oxo-4-phenylmethoxybutanoic acid. InChIKey: VBXORJMTNSIPAW-DEOSSOPVSA-N.
| Molecular formula | C27H25NO6 |
|---|---|
| Molecular weight | 459.5 g/mol |
| IUPAC name | (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-4-oxo-4-phenylmethoxybutanoic acid |
| InChIKey | VBXORJMTNSIPAW-DEOSSOPVSA-N |
| SMILES | CN([C@@H](CC(=O)OCC1=CC=CC=C1)C(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)