CAS 1223998-29-5 appears in our catalog under these names: G0507, G0507, 99.85%, 5-(4-Methoxyphenyl)-6-(5-methyl-2-thienyl)-1H-pyrrolo[2,3-d]pyrimidine-2,4(3H,7H)-dione, 98.33%, 98.33%. Offered by: GLPBio, Biosynth, MedChemExpress, Chemat. Available pack sizes: 5mg, 10mg, 100mg, 50mg, 25mg, 10 mg, 1 mg, 5 mg.
5-(4-methoxyphenyl)-6-(5-methylthiophen-2-yl)-1,7-dihydropyrrolo[2,3-d]pyrimidine-2,4-dione (CAS 1223998-29-5) is a chemical compound with the molecular formula C18H15N3O3S and a molecular weight of 353.4 g/mol. IUPAC name: 5-(4-methoxyphenyl)-6-(5-methylthiophen-2-yl)-1,7-dihydropyrrolo[2,3-d]pyrimidine-2,4-dione. InChIKey: GZLHQRURTUJCHZ-UHFFFAOYSA-N.
| Molecular formula | C18H15N3O3S |
|---|---|
| Molecular weight | 353.4 g/mol |
| IUPAC name | 5-(4-methoxyphenyl)-6-(5-methylthiophen-2-yl)-1,7-dihydropyrrolo[2,3-d]pyrimidine-2,4-dione |
| InChIKey | GZLHQRURTUJCHZ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(S1)C2=C(C3=C(N2)NC(=O)NC3=O)C4=CC=C(C=C4)OC |
Computed by PubChem (NCBI)