CAS 51944-89-9 is the registry number for Sulfasalazine Impurity 26. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
N-[4-(pyridin-2-ylsulfamoyl)phenyl]benzamide (CAS 51944-89-9) is a chemical compound with the molecular formula C18H15N3O3S and a molecular weight of 353.4 g/mol. IUPAC name: N-[4-(pyridin-2-ylsulfamoyl)phenyl]benzamide. InChIKey: NFZSBACEMCULRZ-UHFFFAOYSA-N.
| Molecular formula | C18H15N3O3S |
|---|---|
| Molecular weight | 353.4 g/mol |
| IUPAC name | N-[4-(pyridin-2-ylsulfamoyl)phenyl]benzamide |
| InChIKey | NFZSBACEMCULRZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NC2=CC=C(C=C2)S(=O)(=O)NC3=CC=CC=N3 |
Computed by PubChem (NCBI)