Products 51944-89-9

CAS 51944-89-9 is the registry number for Sulfasalazine Impurity 26. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

N-[4-(pyridin-2-ylsulfamoyl)phenyl]benzamide (CAS 51944-89-9) is a chemical compound with the molecular formula C18H15N3O3S and a molecular weight of 353.4 g/mol. IUPAC name: N-[4-(pyridin-2-ylsulfamoyl)phenyl]benzamide. InChIKey: NFZSBACEMCULRZ-UHFFFAOYSA-N.

Identity
Molecular formulaC18H15N3O3S
Molecular weight353.4 g/mol
IUPAC nameN-[4-(pyridin-2-ylsulfamoyl)phenyl]benzamide
InChIKeyNFZSBACEMCULRZ-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C(=O)NC2=CC=C(C=C2)S(=O)(=O)NC3=CC=CC=N3

Computed by PubChem (NCBI)