CAS 332169-78-5 appears in our catalog under these names: HDAC2–IN–2, HDAC2-IN-2, ≥98%, ≥98%, HDAC2-IN-2, 99.74%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 10 mg, 5 mg.
N-[4-[2-[(4-oxo-3H-quinazolin-2-yl)sulfanyl]acetyl]phenyl]acetamide (CAS 332169-78-5) is a chemical compound with the molecular formula C18H15N3O3S and a molecular weight of 353.4 g/mol. IUPAC name: N-[4-[2-[(4-oxo-3H-quinazolin-2-yl)sulfanyl]acetyl]phenyl]acetamide. InChIKey: LSTRZBSDKHNHDV-UHFFFAOYSA-N.
| Molecular formula | C18H15N3O3S |
|---|---|
| Molecular weight | 353.4 g/mol |
| IUPAC name | N-[4-[2-[(4-oxo-3H-quinazolin-2-yl)sulfanyl]acetyl]phenyl]acetamide |
| InChIKey | LSTRZBSDKHNHDV-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=C(C=C1)C(=O)CSC2=NC3=CC=CC=C3C(=O)N2 |
Computed by PubChem (NCBI)