Products 1358751-53-7
CAS 1358751-53-7 is the registry number for AMPA receptor modulator-11. Offered by: MedChemExpress. Available pack sizes: Get quote.
9-(4-phenoxyphenyl)-3,4-dihydropyrazino[2,1-c][1,2,4]thiadiazine 2,2-dioxide (CAS 1358751-53-7) is a chemical compound with the molecular formula C18H15N3O3S and a molecular weight of 353.4 g/mol. IUPAC name: 9-(4-phenoxyphenyl)-3,4-dihydropyrazino[2,1-c][1,2,4]thiadiazine 2,2-dioxide. InChIKey: JGDQKSZLPSXBSS-UHFFFAOYSA-N.
| Molecular formula | C18H15N3O3S |
|---|---|
| Molecular weight | 353.4 g/mol |
| IUPAC name | 9-(4-phenoxyphenyl)-3,4-dihydropyrazino[2,1-c][1,2,4]thiadiazine 2,2-dioxide |
| InChIKey | JGDQKSZLPSXBSS-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)N=C2N1C=CN=C2C3=CC=C(C=C3)OC4=CC=CC=C4 |
Computed by PubChem (NCBI)