Products 1224164-73-1

CAS 1224164-73-1 is the registry number for 1-(4-Bromophenyl)-5-(1h-pyrrol-1-yl)-1h-pyrazole-4-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

1-(4-bromophenyl)-5-pyrrol-1-ylpyrazole-4-carboxylic acid (CAS 1224164-73-1) is a chemical compound with the molecular formula C14H10BrN3O2 and a molecular weight of 332.15 g/mol. IUPAC name: 1-(4-bromophenyl)-5-pyrrol-1-ylpyrazole-4-carboxylic acid. InChIKey: XJBNVDSPVQJIJA-UHFFFAOYSA-N.

Identity
Molecular formulaC14H10BrN3O2
Molecular weight332.15 g/mol
IUPAC name1-(4-bromophenyl)-5-pyrrol-1-ylpyrazole-4-carboxylic acid
InChIKeyXJBNVDSPVQJIJA-UHFFFAOYSA-N
SMILESC1=CN(C=C1)C2=C(C=NN2C3=CC=C(C=C3)Br)C(=O)O

Computed by PubChem (NCBI)