CAS 1694-67-3 is the registry number for Bromazepam N-Oxide. Offered by: TRC. Available pack sizes: 100mg.
7-bromo-4-hydroxy-5-pyridin-2-yl-3H-1,4-benzodiazepin-2-one (CAS 1694-67-3) is a chemical compound with the molecular formula C14H10BrN3O2 and a molecular weight of 332.15 g/mol. IUPAC name: 7-bromo-4-hydroxy-5-pyridin-2-yl-3H-1,4-benzodiazepin-2-one. InChIKey: FTHPPJSTNKWSPA-UHFFFAOYSA-N.
| Molecular formula | C14H10BrN3O2 |
|---|---|
| Molecular weight | 332.15 g/mol |
| IUPAC name | 7-bromo-4-hydroxy-5-pyridin-2-yl-3H-1,4-benzodiazepin-2-one |
| InChIKey | FTHPPJSTNKWSPA-UHFFFAOYSA-N |
| SMILES | C1C(=O)N=C2C=CC(=CC2=C(N1O)C3=CC=CC=N3)Br |
Computed by PubChem (NCBI)