CAS 1246819-39-5 appears in our catalog under these names: 3-Hydroxy Bromazepam-d4, >95% (HPLC), 3-Hydroxy Bromazepam-d4 (1mg/ml in Methanol), 3-Hydroxy Bromazepam-d4. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1x1ml, Get quote.
7-bromo-3-hydroxy-5-(3,4,5,6-tetradeuterio-2-pyridinyl)-1,3-dihydro-1,4-benzodiazepin-2-one (CAS 1246819-39-5) is a chemical compound with the molecular formula C14H10BrN3O2 and a molecular weight of 336.18 g/mol. IUPAC name: 7-bromo-3-hydroxy-5-(3,4,5,6-tetradeuterio-2-pyridinyl)-1,3-dihydro-1,4-benzodiazepin-2-one. InChIKey: URRUSNGCYBXNLO-VTBMLFEUSA-N.
| Molecular formula | C14H10BrN3O2 |
|---|---|
| Molecular weight | 336.18 g/mol |
| IUPAC name | 7-bromo-3-hydroxy-5-(3,4,5,6-tetradeuterio-2-pyridinyl)-1,3-dihydro-1,4-benzodiazepin-2-one |
| InChIKey | URRUSNGCYBXNLO-VTBMLFEUSA-N |
| SMILES | [2H]C1=C(C(=NC(=C1[2H])C2=NC(C(=O)NC3=C2C=C(C=C3)Br)O)[2H])[2H] |
Computed by PubChem (NCBI)