Products 20648-12-8
CAS 20648-12-8 is the registry number for 2-(4-Bromophenyl)-1-methyl-5-nitro-1H-benzo(d)imidazole. Offered by: TRC. Available pack sizes: 5g.
2-(4-bromophenyl)-1-methyl-5-nitrobenzimidazole (CAS 20648-12-8) is a chemical compound with the molecular formula C14H10BrN3O2 and a molecular weight of 332.15 g/mol. IUPAC name: 2-(4-bromophenyl)-1-methyl-5-nitrobenzimidazole. InChIKey: YGBPUZVNCZHWHH-UHFFFAOYSA-N.
| Molecular formula | C14H10BrN3O2 |
|---|---|
| Molecular weight | 332.15 g/mol |
| IUPAC name | 2-(4-bromophenyl)-1-methyl-5-nitrobenzimidazole |
| InChIKey | YGBPUZVNCZHWHH-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)[N+](=O)[O-])N=C1C3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)