Products 1224571-03-2
CAS 1224571-03-2 is the registry number for Immunosuppressant-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[(E)-C-[(4-bromophenyl)methyl]-N-hydroxycarbonimidoyl]benzene-1,2-diol (CAS 1224571-03-2) is a chemical compound with the molecular formula C14H12BrNO3 and a molecular weight of 322.15 g/mol. IUPAC name: 4-[(E)-C-[(4-bromophenyl)methyl]-N-hydroxycarbonimidoyl]benzene-1,2-diol. InChIKey: QMXNEVOYCHZVSJ-FOWTUZBSSA-N.
| Molecular formula | C14H12BrNO3 |
|---|---|
| Molecular weight | 322.15 g/mol |
| IUPAC name | 4-[(E)-C-[(4-bromophenyl)methyl]-N-hydroxycarbonimidoyl]benzene-1,2-diol |
| InChIKey | QMXNEVOYCHZVSJ-FOWTUZBSSA-N |
| SMILES | C1=CC(=CC=C1C/C(=N\O)/C2=CC(=C(C=C2)O)O)Br |
Computed by PubChem (NCBI)
Synonyms:
Immunosuppressant-1, orb2277680