CAS 1308617-84-6 appears in our catalog under these names: 4-{((3-bromo-2-hydroxyphenyl)methyl)amino}benzoic acid, 95%, 4-{((3-Bromo-2-hydroxyphenyl)methyl)amino}benzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4-[(3-bromo-2-hydroxyphenyl)methylamino]benzoic acid (CAS 1308617-84-6) is a chemical compound with the molecular formula C14H12BrNO3 and a molecular weight of 322.15 g/mol. IUPAC name: 4-[(3-bromo-2-hydroxyphenyl)methylamino]benzoic acid. InChIKey: VCQYDLJYRRJXIA-UHFFFAOYSA-N.
| Molecular formula | C14H12BrNO3 |
|---|---|
| Molecular weight | 322.15 g/mol |
| IUPAC name | 4-[(3-bromo-2-hydroxyphenyl)methylamino]benzoic acid |
| InChIKey | VCQYDLJYRRJXIA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)O)CNC2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)