Products 202058-46-6
CAS 202058-46-6 appears in our catalog under these names: 1H-Isoindole-1,3(2H)-dione, 2-(3-bromo-4-oxocyclohexyl)-, 97%, 2-(3-Bromo-4-oxocyclohexyl)isoindoline-1,3-dione, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
2-(3-bromo-4-oxocyclohexyl)isoindole-1,3-dione (CAS 202058-46-6) is a chemical compound with the molecular formula C14H12BrNO3 and a molecular weight of 322.15 g/mol. IUPAC name: 2-(3-bromo-4-oxocyclohexyl)isoindole-1,3-dione. InChIKey: BCCYERBPLFVKSP-UHFFFAOYSA-N.
| Molecular formula | C14H12BrNO3 |
|---|---|
| Molecular weight | 322.15 g/mol |
| IUPAC name | 2-(3-bromo-4-oxocyclohexyl)isoindole-1,3-dione |
| InChIKey | BCCYERBPLFVKSP-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C(CC1N2C(=O)C3=CC=CC=C3C2=O)Br |
Computed by PubChem (NCBI)