Products 2891597-29-6
CAS 2891597-29-6 is the registry number for 5-Bromo-1,3-dimethyl-2-(4-nitrophenoxy)benzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
5-bromo-1,3-dimethyl-2-(4-nitrophenoxy)benzene (CAS 2891597-29-6) is a chemical compound with the molecular formula C14H12BrNO3 and a molecular weight of 322.15 g/mol. IUPAC name: 5-bromo-1,3-dimethyl-2-(4-nitrophenoxy)benzene. InChIKey: ACJXAWUWRRXXSM-UHFFFAOYSA-N.
| Molecular formula | C14H12BrNO3 |
|---|---|
| Molecular weight | 322.15 g/mol |
| IUPAC name | 5-bromo-1,3-dimethyl-2-(4-nitrophenoxy)benzene |
| InChIKey | ACJXAWUWRRXXSM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1OC2=CC=C(C=C2)[N+](=O)[O-])C)Br |
Computed by PubChem (NCBI)