CAS 1224640-26-9 is the registry number for 7-Fluoro-1,2,3,4-tetrahydroquinoline hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 1g, 2g.
7-fluoro-1,2,3,4-tetrahydroquinoline;hydrochloride (CAS 1224640-26-9) is a chemical compound with the molecular formula C9H11ClFN and a molecular weight of 187.64 g/mol. IUPAC name: 7-fluoro-1,2,3,4-tetrahydroquinoline;hydrochloride. InChIKey: PFYILBIVIWNOLY-UHFFFAOYSA-N.
| Molecular formula | C9H11ClFN |
|---|---|
| Molecular weight | 187.64 g/mol |
| IUPAC name | 7-fluoro-1,2,3,4-tetrahydroquinoline;hydrochloride |
| InChIKey | PFYILBIVIWNOLY-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=C(C=C2)F)NC1.Cl |
Computed by PubChem (NCBI)