Products 122520-74-5
CAS 122520-74-5 is the registry number for 2-Cyano-3-(4-fluoro-phenyl)-acrylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
(E)-2-cyano-3-(4-fluorophenyl)prop-2-enoic acid (CAS 122520-74-5) is a chemical compound with the molecular formula C10H6FNO2 and a molecular weight of 191.16 g/mol. IUPAC name: (E)-2-cyano-3-(4-fluorophenyl)prop-2-enoic acid. InChIKey: OBZAFMILNGLRAL-VMPITWQZSA-N.
| Molecular formula | C10H6FNO2 |
|---|---|
| Molecular weight | 191.16 g/mol |
| IUPAC name | (E)-2-cyano-3-(4-fluorophenyl)prop-2-enoic acid |
| InChIKey | OBZAFMILNGLRAL-VMPITWQZSA-N |
| SMILES | C1=CC(=CC=C1/C=C(\C#N)/C(=O)O)F |
Computed by PubChem (NCBI)
Synonyms:
2-Cyano-3-(4-fluorophenyl)acrylic acid, (E)-2-Cyano-3-(4-fluorophenyl)acrylic acid, 2-cyano-3-(4-fluorophenyl)prop-2-enoic acid, (E)-2-cyano-3-(4-fluorophenyl)prop-2-enoic acid, (2E)-2-cyano-3-(4-fluorophenyl)prop-2-enoic acid, OBZAFMILNGLRAL-VMPITWQZSA-N, benzylidenemalononitrile (BMN) deriv. 28, (E)-2-Cyano-3-(4-fluorophenyl)-2-propenoic acid, alpha-Cyano-4-fluorocinnamic acid, matrix substance for MALDI-MS, >=95.0% (HPLC)