Products 1225482-27-8

CAS 1225482-27-8 is the registry number for 2-(4-Bromophenyl)-5-methyl-1H-imidazole-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-(4-bromophenyl)-5-methyl-1H-imidazole-4-carboxylic acid (CAS 1225482-27-8) is a chemical compound with the molecular formula C11H9BrN2O2 and a molecular weight of 281.10 g/mol. IUPAC name: 2-(4-bromophenyl)-5-methyl-1H-imidazole-4-carboxylic acid. InChIKey: PDTBCPQKUWVVGZ-UHFFFAOYSA-N.

Identity
Molecular formulaC11H9BrN2O2
Molecular weight281.10 g/mol
IUPAC name2-(4-bromophenyl)-5-methyl-1H-imidazole-4-carboxylic acid
InChIKeyPDTBCPQKUWVVGZ-UHFFFAOYSA-N
SMILESCC1=C(N=C(N1)C2=CC=C(C=C2)Br)C(=O)O

Computed by PubChem (NCBI)