CAS 1225599-81-4 is the registry number for 2-(Difluoromethoxy)-1,3,5-trimethylbenzene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(difluoromethoxy)-1,3,5-trimethylbenzene (CAS 1225599-81-4) is a chemical compound with the molecular formula C10H12F2O and a molecular weight of 186.20 g/mol. IUPAC name: 2-(difluoromethoxy)-1,3,5-trimethylbenzene. InChIKey: WDKNGQGPCPWOQR-UHFFFAOYSA-N.
| Molecular formula | C10H12F2O |
|---|---|
| Molecular weight | 186.20 g/mol |
| IUPAC name | 2-(difluoromethoxy)-1,3,5-trimethylbenzene |
| InChIKey | WDKNGQGPCPWOQR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)OC(F)F)C |
Computed by PubChem (NCBI)