CAS 959574-01-7 is the registry number for 1-(tert-Butoxy)-2,3-difluorobenzene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1,2-difluoro-3-[(2-methylpropan-2-yl)oxy]benzene (CAS 959574-01-7) is a chemical compound with the molecular formula C10H12F2O and a molecular weight of 186.20 g/mol. IUPAC name: 1,2-difluoro-3-[(2-methylpropan-2-yl)oxy]benzene. InChIKey: CWJJOGNTAIIXGE-UHFFFAOYSA-N.
| Molecular formula | C10H12F2O |
|---|---|
| Molecular weight | 186.20 g/mol |
| IUPAC name | 1,2-difluoro-3-[(2-methylpropan-2-yl)oxy]benzene |
| InChIKey | CWJJOGNTAIIXGE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC1=C(C(=CC=C1)F)F |
Computed by PubChem (NCBI)