CAS 953091-22-0 is the registry number for 4-(tert-Butyl)-2,6-difluorophenol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-tert-butyl-2,6-difluorophenol (CAS 953091-22-0) is a chemical compound with the molecular formula C10H12F2O and a molecular weight of 186.20 g/mol. IUPAC name: 4-tert-butyl-2,6-difluorophenol. InChIKey: LTCZIPBXQXTKKR-UHFFFAOYSA-N.
| Molecular formula | C10H12F2O |
|---|---|
| Molecular weight | 186.20 g/mol |
| IUPAC name | 4-tert-butyl-2,6-difluorophenol |
| InChIKey | LTCZIPBXQXTKKR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C(=C1)F)O)F |
Computed by PubChem (NCBI)