CAS 910486-78-1 appears in our catalog under these names: 4-(tert-Butyl)-3,5-difluorophenol, 95%, 4–(tert–Butyl)–3,5–difluorophenol, 4-(tert-Butyl)-3,5-difluorophenol, ≥95%, ≥95%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 1g, 250mg, 100mg.
4-tert-butyl-3,5-difluorophenol (CAS 910486-78-1) is a chemical compound with the molecular formula C10H12F2O and a molecular weight of 186.20 g/mol. IUPAC name: 4-tert-butyl-3,5-difluorophenol. InChIKey: DMBJHRKFWWSSOC-UHFFFAOYSA-N.
| Molecular formula | C10H12F2O |
|---|---|
| Molecular weight | 186.20 g/mol |
| IUPAC name | 4-tert-butyl-3,5-difluorophenol |
| InChIKey | DMBJHRKFWWSSOC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=C(C=C(C=C1F)O)F |
Computed by PubChem (NCBI)