CAS 1225957-41-4 is the registry number for 3'-Chloro-4-methyl-[1,1'-biphenyl]-3-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(3-chlorophenyl)-2-methylaniline (CAS 1225957-41-4) is a chemical compound with the molecular formula C13H12ClN and a molecular weight of 217.69 g/mol. IUPAC name: 5-(3-chlorophenyl)-2-methylaniline. InChIKey: JXBANRWYIZFOEN-UHFFFAOYSA-N.
| Molecular formula | C13H12ClN |
|---|---|
| Molecular weight | 217.69 g/mol |
| IUPAC name | 5-(3-chlorophenyl)-2-methylaniline |
| InChIKey | JXBANRWYIZFOEN-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C2=CC(=CC=C2)Cl)N |
Computed by PubChem (NCBI)