Products 1226507-37-4
CAS 1226507-37-4 is the registry number for 3-(2,2,2-Trifluoro-1-hydroxyethyl)benzonitrile, 96%. Offered by: Fluorochem, Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg.
3-(2,2,2-trifluoro-1-hydroxyethyl)benzonitrile (CAS 1226507-37-4) is a chemical compound with the molecular formula C9H6F3NO and a molecular weight of 201.14 g/mol. IUPAC name: 3-(2,2,2-trifluoro-1-hydroxyethyl)benzonitrile. InChIKey: LBZZRKWNYXSDDK-UHFFFAOYSA-N.
| Molecular formula | C9H6F3NO |
|---|---|
| Molecular weight | 201.14 g/mol |
| IUPAC name | 3-(2,2,2-trifluoro-1-hydroxyethyl)benzonitrile |
| InChIKey | LBZZRKWNYXSDDK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(C(F)(F)F)O)C#N |
Computed by PubChem (NCBI)