CAS 122665-61-6 is the registry number for 3-Methoxy-4-(pivaloyloxy)benzoic Acid. Offered by: TRC. Available pack sizes: 1g, 2,5g, 5g.
4-(2,2-dimethylpropanoyloxy)-3-methoxybenzoic acid (CAS 122665-61-6) is a chemical compound with the molecular formula C13H16O5 and a molecular weight of 252.26 g/mol. IUPAC name: 4-(2,2-dimethylpropanoyloxy)-3-methoxybenzoic acid. InChIKey: CYMGBFZOQMAKRL-UHFFFAOYSA-N.
| Molecular formula | C13H16O5 |
|---|---|
| Molecular weight | 252.26 g/mol |
| IUPAC name | 4-(2,2-dimethylpropanoyloxy)-3-methoxybenzoic acid |
| InChIKey | CYMGBFZOQMAKRL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)OC1=C(C=C(C=C1)C(=O)O)OC |
Computed by PubChem (NCBI)